C10H16N2O3S3 — CID 103526684
3-amino-N-ethyl-4-ethylsulfonyl-5-methylsulfanylthiophene-2-carboxamide (PubChem CID 103526684) has the molecular formula C10H16N2O3S3 and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-amino-N-ethyl-4-ethylsulfonyl-5-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-N-ethyl-4-ethylsulfonyl-5-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103526684 |
| Molecular Formula | C10H16N2O3S3 |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 3-amino-N-ethyl-4-ethylsulfonyl-5-methylsulfanylthiophene-2-carboxamide |
| SMILES | CCNC(=O)c1sc(SC)c(S(=O)(=O)CC)c1N |
| InChI | InChI=1S/C10H16N2O3S3/c1-4-12-9(13)7-6(11)8(10(16-3)17-7)18(14,15)5-2/h4-5,11H2,1-3H3,(H,12,13) |
| InChIKey | XBYXKXMGYHLQBL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |