C7H10N2O3S3 — CID 103526743
3-amino-5-methylsulfanyl-4-methylsulfonylthiophene-2-carboxamide (PubChem CID 103526743) has the molecular formula C7H10N2O3S3 and a molecular weight of 266.37 g/mol. Its IUPAC name is 3-amino-5-methylsulfanyl-4-methylsulfonylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-methylsulfanyl-4-methylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103526743 |
| Molecular Formula | C7H10N2O3S3 |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 3-amino-5-methylsulfanyl-4-methylsulfonylthiophene-2-carboxamide |
| SMILES | CSc1sc(C(N)=O)c(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C7H10N2O3S3/c1-13-7-5(15(2,11)12)3(8)4(14-7)6(9)10/h8H2,1-2H3,(H2,9,10) |
| InChIKey | YSSBOFCEJIQALN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |