C11H20N4O3S2 — CID 103506984
3-amino-5-[2-(dimethylamino)propylamino]-4-methylsulfonylthiophene-2-carboxamide (PubChem CID 103506984) has the molecular formula C11H20N4O3S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-amino-5-[2-(dimethylamino)propylamino]-4-methylsulfonylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[2-(dimethylamino)propylamino]-4-methylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103506984 |
| Molecular Formula | C11H20N4O3S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 3-amino-5-[2-(dimethylamino)propylamino]-4-methylsulfonylthiophene-2-carboxamide |
| SMILES | CC(CNc1sc(C(N)=O)c(N)c1S(C)(=O)=O)N(C)C |
| InChI | InChI=1S/C11H20N4O3S2/c1-6(15(2)3)5-14-11-9(20(4,17)18)7(12)8(19-11)10(13)16/h6,14H,5,12H2,1-4H3,(H2,13,16) |
| InChIKey | HTHCGDOCOCKHCU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |