C11H17N3O4S2 — CID 103507182
3-amino-4-methylsulfonyl-5-(oxolan-3-ylmethylamino)thiophene-2-carboxamide (PubChem CID 103507182) has the molecular formula C11H17N3O4S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-amino-4-methylsulfonyl-5-(oxolan-3-ylmethylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-4-methylsulfonyl-5-(oxolan-3-ylmethylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103507182 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-amino-4-methylsulfonyl-5-(oxolan-3-ylmethylamino)thiophene-2-carboxamide |
| SMILES | CS(=O)(=O)c1c(NCC2CCOC2)sc(C(N)=O)c1N |
| InChI | InChI=1S/C11H17N3O4S2/c1-20(16,17)9-7(12)8(10(13)15)19-11(9)14-4-6-2-3-18-5-6/h6,14H,2-5,12H2,1H3,(H2,13,15) |
| InChIKey | FHMLWSQXAJRUSS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |