C11H19N5O3S2 — CID 103505871
3-amino-5-[(4-methylpiperazin-1-yl)amino]-4-methylsulfonylthiophene-2-carboxamide (PubChem CID 103505871) has the molecular formula C11H19N5O3S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 3-amino-5-[(4-methylpiperazin-1-yl)amino]-4-methylsulfonylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[(4-methylpiperazin-1-yl)amino]-4-methylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103505871 |
| Molecular Formula | C11H19N5O3S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-amino-5-[(4-methylpiperazin-1-yl)amino]-4-methylsulfonylthiophene-2-carboxamide |
| SMILES | CN1CCN(Nc2sc(C(N)=O)c(N)c2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C11H19N5O3S2/c1-15-3-5-16(6-4-15)14-11-9(21(2,18)19)7(12)8(20-11)10(13)17/h14H,3-6,12H2,1-2H3,(H2,13,17) |
| InChIKey | LIMANDILONXTEF-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |