C13H22N4O2S2 — CID 103505852
ethyl 3-amino-5-[(4-methylpiperazin-1-yl)amino]-4-methylsulfanylthiophene-2-carboxylate (PubChem CID 103505852) has the molecular formula C13H22N4O2S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is ethyl 3-amino-5-[(4-methylpiperazin-1-yl)amino]-4-methylsulfanylthiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-5-[(4-methylpiperazin-1-yl)amino]-4-methylsulfanylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 103505852 |
| Molecular Formula | C13H22N4O2S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | ethyl 3-amino-5-[(4-methylpiperazin-1-yl)amino]-4-methylsulfanylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NN2CCN(C)CC2)c(SC)c1N |
| InChI | InChI=1S/C13H22N4O2S2/c1-4-19-13(18)11-9(14)10(20-3)12(21-11)15-17-7-5-16(2)6-8-17/h15H,4-8,14H2,1-3H3 |
| InChIKey | DKQQXJIXPBMLMM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |