C12H19N3OS2 — CID 103419298
1-[3-amino-5-(4-methylpiperazin-1-yl)-4-methylsulfanylthiophen-2-yl]ethanone (PubChem CID 103419298) has the molecular formula C12H19N3OS2 and a molecular weight of 285.44 g/mol. Its IUPAC name is 1-[3-amino-5-(4-methylpiperazin-1-yl)-4-methylsulfanylthiophen-2-yl]ethanone.
| Compound Name | 1-[3-amino-5-(4-methylpiperazin-1-yl)-4-methylsulfanylthiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 103419298 |
| Molecular Formula | C12H19N3OS2 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-[3-amino-5-(4-methylpiperazin-1-yl)-4-methylsulfanylthiophen-2-yl]ethanone |
| SMILES | CSc1c(N2CCN(C)CC2)sc(C(C)=O)c1N |
| InChI | InChI=1S/C12H19N3OS2/c1-8(16)10-9(13)11(17-3)12(18-10)15-6-4-14(2)5-7-15/h4-7,13H2,1-3H3 |
| InChIKey | GGPWTHMCUPWYOG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |