C15H25N3OS2 — CID 103422018
1-[3-amino-5-[3-(diethylamino)pyrrolidin-1-yl]-4-methylsulfanylthiophen-2-yl]ethanone (PubChem CID 103422018) has the molecular formula C15H25N3OS2 and a molecular weight of 327.52 g/mol. Its IUPAC name is 1-[3-amino-5-[3-(diethylamino)pyrrolidin-1-yl]-4-methylsulfanylthiophen-2-yl]ethanone.
| Compound Name | 1-[3-amino-5-[3-(diethylamino)pyrrolidin-1-yl]-4-methylsulfanylthiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 103422018 |
| Molecular Formula | C15H25N3OS2 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[3-amino-5-[3-(diethylamino)pyrrolidin-1-yl]-4-methylsulfanylthiophen-2-yl]ethanone |
| SMILES | CCN(CC)C1CCN(c2sc(C(C)=O)c(N)c2SC)C1 |
| InChI | InChI=1S/C15H25N3OS2/c1-5-17(6-2)11-7-8-18(9-11)15-14(20-4)12(16)13(21-15)10(3)19/h11H,5-9,16H2,1-4H3 |
| InChIKey | GVPVFJHYDSUEEN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |