C11H17N3O2S2 — CID 103542403
3-amino-5-(3-methoxypyrrolidin-1-yl)-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103542403) has the molecular formula C11H17N3O2S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-amino-5-(3-methoxypyrrolidin-1-yl)-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(3-methoxypyrrolidin-1-yl)-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103542403 |
| Molecular Formula | C11H17N3O2S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-amino-5-(3-methoxypyrrolidin-1-yl)-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | COC1CCN(c2sc(C(N)=O)c(N)c2SC)C1 |
| InChI | InChI=1S/C11H17N3O2S2/c1-16-6-3-4-14(5-6)11-9(17-2)7(12)8(18-11)10(13)15/h6H,3-5,12H2,1-2H3,(H2,13,15) |
| InChIKey | ZWLLZSNCIQKTPS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |