C13H20N4OS2 — CID 103505433
5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-amino-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103505433) has the molecular formula C13H20N4OS2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-amino-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-amino-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103505433 |
| Molecular Formula | C13H20N4OS2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-amino-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CSc1c(N2CCN3CCCC3C2)sc(C(N)=O)c1N |
| InChI | InChI=1S/C13H20N4OS2/c1-19-11-9(14)10(12(15)18)20-13(11)17-6-5-16-4-2-3-8(16)7-17/h8H,2-7,14H2,1H3,(H2,15,18) |
| InChIKey | PPHXUJHPMQXRRT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |