C15H23N3OS2 — CID 103505428
1-[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-amino-4-methylsulfanylthiophen-2-yl]propan-1-one (PubChem CID 103505428) has the molecular formula C15H23N3OS2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 1-[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-amino-4-methylsulfanylthiophen-2-yl]propan-1-one.
| Compound Name | 1-[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-amino-4-methylsulfanylthiophen-2-yl]propan-1-one |
|---|---|
| PubChem CID | 103505428 |
| Molecular Formula | C15H23N3OS2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-amino-4-methylsulfanylthiophen-2-yl]propan-1-one |
| SMILES | CCC(=O)c1sc(N2CCN3CCCC3C2)c(SC)c1N |
| InChI | InChI=1S/C15H23N3OS2/c1-3-11(19)13-12(16)14(20-2)15(21-13)18-8-7-17-6-4-5-10(17)9-18/h10H,3-9,16H2,1-2H3 |
| InChIKey | DCZJXLBHMZDUEO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |