C13H21N3OS2 — CID 103418839
3-amino-N-methyl-5-(4-methylpiperidin-1-yl)-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103418839) has the molecular formula C13H21N3OS2 and a molecular weight of 299.47 g/mol. Its IUPAC name is 3-amino-N-methyl-5-(4-methylpiperidin-1-yl)-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-N-methyl-5-(4-methylpiperidin-1-yl)-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103418839 |
| Molecular Formula | C13H21N3OS2 |
| Molecular Weight | 299.47 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-amino-N-methyl-5-(4-methylpiperidin-1-yl)-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CNC(=O)c1sc(N2CCC(C)CC2)c(SC)c1N |
| InChI | InChI=1S/C13H21N3OS2/c1-8-4-6-16(7-5-8)13-11(18-3)9(14)10(19-13)12(17)15-2/h8H,4-7,14H2,1-3H3,(H,15,17) |
| InChIKey | SDUHWOISIULZAG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |