C15H23N3OS2 — CID 103419637
3-amino-5-(azepan-1-yl)-N-cyclopropyl-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103419637) has the molecular formula C15H23N3OS2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 3-amino-5-(azepan-1-yl)-N-cyclopropyl-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(azepan-1-yl)-N-cyclopropyl-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103419637 |
| Molecular Formula | C15H23N3OS2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-amino-5-(azepan-1-yl)-N-cyclopropyl-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CSc1c(N2CCCCCC2)sc(C(=O)NC2CC2)c1N |
| InChI | InChI=1S/C15H23N3OS2/c1-20-13-11(16)12(14(19)17-10-6-7-10)21-15(13)18-8-4-2-3-5-9-18/h10H,2-9,16H2,1H3,(H,17,19) |
| InChIKey | WUJJAHYHBFDORR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |