C13H20N4O2S — CID 103525009
3-amino-N-cyclopropyl-4-methoxy-5-piperazin-1-ylthiophene-2-carboxamide (PubChem CID 103525009) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-4-methoxy-5-piperazin-1-ylthiophene-2-carboxamide.
| Compound Name | 3-amino-N-cyclopropyl-4-methoxy-5-piperazin-1-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103525009 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-amino-N-cyclopropyl-4-methoxy-5-piperazin-1-ylthiophene-2-carboxamide |
| SMILES | COc1c(N2CCNCC2)sc(C(=O)NC2CC2)c1N |
| InChI | InChI=1S/C13H20N4O2S/c1-19-10-9(14)11(12(18)16-8-2-3-8)20-13(10)17-6-4-15-5-7-17/h8,15H,2-7,14H2,1H3,(H,16,18) |
| InChIKey | NOVGEQBPQAIITH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |