C12H17N3O3S — CID 103524937
methyl 5-acetyl-4-amino-2-piperazin-1-ylthiophene-3-carboxylate (PubChem CID 103524937) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is methyl 5-acetyl-4-amino-2-piperazin-1-ylthiophene-3-carboxylate.
| Compound Name | methyl 5-acetyl-4-amino-2-piperazin-1-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 103524937 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | methyl 5-acetyl-4-amino-2-piperazin-1-ylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2CCNCC2)sc(C(C)=O)c1N |
| InChI | InChI=1S/C12H17N3O3S/c1-7(16)10-9(13)8(12(17)18-2)11(19-10)15-5-3-14-4-6-15/h14H,3-6,13H2,1-2H3 |
| InChIKey | KSPMIZVCRDSQSS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |