C12H18N4O3S — CID 103419338
methyl 4-amino-5-carbamoyl-2-(4-methylpiperazin-1-yl)thiophene-3-carboxylate (PubChem CID 103419338) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is methyl 4-amino-5-carbamoyl-2-(4-methylpiperazin-1-yl)thiophene-3-carboxylate.
| Compound Name | methyl 4-amino-5-carbamoyl-2-(4-methylpiperazin-1-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103419338 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | methyl 4-amino-5-carbamoyl-2-(4-methylpiperazin-1-yl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2CCN(C)CC2)sc(C(N)=O)c1N |
| InChI | InChI=1S/C12H18N4O3S/c1-15-3-5-16(6-4-15)11-7(12(18)19-2)8(13)9(20-11)10(14)17/h3-6,13H2,1-2H3,(H2,14,17) |
| InChIKey | XLYDOJJYSIHXCB-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |