C11H15N3O4S — CID 103419080
methyl 3-amino-4-carbamoyl-5-morpholin-4-ylthiophene-2-carboxylate (PubChem CID 103419080) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is methyl 3-amino-4-carbamoyl-5-morpholin-4-ylthiophene-2-carboxylate.
| Compound Name | methyl 3-amino-4-carbamoyl-5-morpholin-4-ylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 103419080 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | methyl 3-amino-4-carbamoyl-5-morpholin-4-ylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(N2CCOCC2)c(C(N)=O)c1N |
| InChI | InChI=1S/C11H15N3O4S/c1-17-11(16)8-7(12)6(9(13)15)10(19-8)14-2-4-18-5-3-14/h2-5,12H2,1H3,(H2,13,15) |
| InChIKey | KJKMVPFLRUOESM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |