C12H17N3O4S — CID 103419039
methyl 3-amino-4-(methylcarbamoyl)-5-morpholin-4-ylthiophene-2-carboxylate (PubChem CID 103419039) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is methyl 3-amino-4-(methylcarbamoyl)-5-morpholin-4-ylthiophene-2-carboxylate.
| Compound Name | methyl 3-amino-4-(methylcarbamoyl)-5-morpholin-4-ylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 103419039 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | methyl 3-amino-4-(methylcarbamoyl)-5-morpholin-4-ylthiophene-2-carboxylate |
| SMILES | CNC(=O)c1c(N2CCOCC2)sc(C(=O)OC)c1N |
| InChI | InChI=1S/C12H17N3O4S/c1-14-10(16)7-8(13)9(12(17)18-2)20-11(7)15-3-5-19-6-4-15/h3-6,13H2,1-2H3,(H,14,16) |
| InChIKey | GPRQYZRFUJZJBO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |