C12H16N2O4S — CID 103421580
methyl 5-acetyl-4-amino-2-(3-hydroxypyrrolidin-1-yl)thiophene-3-carboxylate (PubChem CID 103421580) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is methyl 5-acetyl-4-amino-2-(3-hydroxypyrrolidin-1-yl)thiophene-3-carboxylate.
| Compound Name | methyl 5-acetyl-4-amino-2-(3-hydroxypyrrolidin-1-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103421580 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | methyl 5-acetyl-4-amino-2-(3-hydroxypyrrolidin-1-yl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2CCC(O)C2)sc(C(C)=O)c1N |
| InChI | InChI=1S/C12H16N2O4S/c1-6(15)10-9(13)8(12(17)18-2)11(19-10)14-4-3-7(16)5-14/h7,16H,3-5,13H2,1-2H3 |
| InChIKey | DVBJUTQULIREQU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |