C13H20N4O3S — CID 103525739
methyl 4-amino-2-(3-aminopyrrolidin-1-yl)-5-(ethylcarbamoyl)thiophene-3-carboxylate (PubChem CID 103525739) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is methyl 4-amino-2-(3-aminopyrrolidin-1-yl)-5-(ethylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | methyl 4-amino-2-(3-aminopyrrolidin-1-yl)-5-(ethylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103525739 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | methyl 4-amino-2-(3-aminopyrrolidin-1-yl)-5-(ethylcarbamoyl)thiophene-3-carboxylate |
| SMILES | CCNC(=O)c1sc(N2CCC(N)C2)c(C(=O)OC)c1N |
| InChI | InChI=1S/C13H20N4O3S/c1-3-16-11(18)10-9(15)8(13(19)20-2)12(21-10)17-5-4-7(14)6-17/h7H,3-6,14-15H2,1-2H3,(H,16,18) |
| InChIKey | KWOLPNYMYDQEKS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |