C13H19N3O3S2 — CID 103507480
methyl 4-amino-5-(methylcarbamoyl)-2-(2-methylthiomorpholin-4-yl)thiophene-3-carboxylate (PubChem CID 103507480) has the molecular formula C13H19N3O3S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is methyl 4-amino-5-(methylcarbamoyl)-2-(2-methylthiomorpholin-4-yl)thiophene-3-carboxylate.
| Compound Name | methyl 4-amino-5-(methylcarbamoyl)-2-(2-methylthiomorpholin-4-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103507480 |
| Molecular Formula | C13H19N3O3S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | methyl 4-amino-5-(methylcarbamoyl)-2-(2-methylthiomorpholin-4-yl)thiophene-3-carboxylate |
| SMILES | CNC(=O)c1sc(N2CCSC(C)C2)c(C(=O)OC)c1N |
| InChI | InChI=1S/C13H19N3O3S2/c1-7-6-16(4-5-20-7)12-8(13(18)19-3)9(14)10(21-12)11(17)15-2/h7H,4-6,14H2,1-3H3,(H,15,17) |
| InChIKey | ZCJRNEWDJRNNDP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |