C11H16N4O2S2 — CID 103418473
3-amino-2-N-methyl-5-thiomorpholin-4-ylthiophene-2,4-dicarboxamide (PubChem CID 103418473) has the molecular formula C11H16N4O2S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 3-amino-2-N-methyl-5-thiomorpholin-4-ylthiophene-2,4-dicarboxamide.
| Compound Name | 3-amino-2-N-methyl-5-thiomorpholin-4-ylthiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 103418473 |
| Molecular Formula | C11H16N4O2S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 3-amino-2-N-methyl-5-thiomorpholin-4-ylthiophene-2,4-dicarboxamide |
| SMILES | CNC(=O)c1sc(N2CCSCC2)c(C(N)=O)c1N |
| InChI | InChI=1S/C11H16N4O2S2/c1-14-10(17)8-7(12)6(9(13)16)11(19-8)15-2-4-18-5-3-15/h2-5,12H2,1H3,(H2,13,16)(H,14,17) |
| InChIKey | RLCGOYFCEGLRHU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |