C12H18N2O4S3 — CID 103507508
methyl 3-amino-4-methylsulfonyl-5-(2-methylthiomorpholin-4-yl)thiophene-2-carboxylate (PubChem CID 103507508) has the molecular formula C12H18N2O4S3 and a molecular weight of 350.49 g/mol. Its IUPAC name is methyl 3-amino-4-methylsulfonyl-5-(2-methylthiomorpholin-4-yl)thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-4-methylsulfonyl-5-(2-methylthiomorpholin-4-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103507508 |
| Molecular Formula | C12H18N2O4S3 |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | methyl 3-amino-4-methylsulfonyl-5-(2-methylthiomorpholin-4-yl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(N2CCSC(C)C2)c(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C12H18N2O4S3/c1-7-6-14(4-5-19-7)11-10(21(3,16)17)8(13)9(20-11)12(15)18-2/h7H,4-6,13H2,1-3H3 |
| InChIKey | RMROLLBROOMJNH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |