C14H19N3OS2 — CID 103507460
4-amino-5-(2-methylpropanoyl)-2-(2-methylthiomorpholin-4-yl)thiophene-3-carbonitrile (PubChem CID 103507460) has the molecular formula C14H19N3OS2 and a molecular weight of 309.46 g/mol. Its IUPAC name is 4-amino-5-(2-methylpropanoyl)-2-(2-methylthiomorpholin-4-yl)thiophene-3-carbonitrile.
| Compound Name | 4-amino-5-(2-methylpropanoyl)-2-(2-methylthiomorpholin-4-yl)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 103507460 |
| Molecular Formula | C14H19N3OS2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-amino-5-(2-methylpropanoyl)-2-(2-methylthiomorpholin-4-yl)thiophene-3-carbonitrile |
| SMILES | CC1CN(c2sc(C(=O)C(C)C)c(N)c2C#N)CCS1 |
| InChI | InChI=1S/C14H19N3OS2/c1-8(2)12(18)13-11(16)10(6-15)14(20-13)17-4-5-19-9(3)7-17/h8-9H,4-5,7,16H2,1-3H3 |
| InChIKey | MCISBUUPNPKUJH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |