C14H21N3O2S2 — CID 103507469
3-amino-N-cyclopropyl-4-methoxy-5-(2-methylthiomorpholin-4-yl)thiophene-2-carboxamide (PubChem CID 103507469) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.48 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-4-methoxy-5-(2-methylthiomorpholin-4-yl)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-cyclopropyl-4-methoxy-5-(2-methylthiomorpholin-4-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103507469 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 3-amino-N-cyclopropyl-4-methoxy-5-(2-methylthiomorpholin-4-yl)thiophene-2-carboxamide |
| SMILES | COc1c(N2CCSC(C)C2)sc(C(=O)NC2CC2)c1N |
| InChI | InChI=1S/C14H21N3O2S2/c1-8-7-17(5-6-20-8)14-11(19-2)10(15)12(21-14)13(18)16-9-3-4-9/h8-9H,3-7,15H2,1-2H3,(H,16,18) |
| InChIKey | KGQRAKHAPAWDDY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |