C12H19N3O4S2 — CID 103525627
methyl 3-amino-5-(4-aminopiperidin-1-yl)-4-methylsulfonylthiophene-2-carboxylate (PubChem CID 103525627) has the molecular formula C12H19N3O4S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is methyl 3-amino-5-(4-aminopiperidin-1-yl)-4-methylsulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-amino-5-(4-aminopiperidin-1-yl)-4-methylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 103525627 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | methyl 3-amino-5-(4-aminopiperidin-1-yl)-4-methylsulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(N2CCC(N)CC2)c(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C12H19N3O4S2/c1-19-12(16)9-8(14)10(21(2,17)18)11(20-9)15-5-3-7(13)4-6-15/h7H,3-6,13-14H2,1-2H3 |
| InChIKey | DEGBLPSSTRSNAR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |