C13H21N3O3S2 — CID 103509700
3-amino-N-ethyl-5-(3-methylpyrrolidin-1-yl)-4-methylsulfonylthiophene-2-carboxamide (PubChem CID 103509700) has the molecular formula C13H21N3O3S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-amino-N-ethyl-5-(3-methylpyrrolidin-1-yl)-4-methylsulfonylthiophene-2-carboxamide.
| Compound Name | 3-amino-N-ethyl-5-(3-methylpyrrolidin-1-yl)-4-methylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103509700 |
| Molecular Formula | C13H21N3O3S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-amino-N-ethyl-5-(3-methylpyrrolidin-1-yl)-4-methylsulfonylthiophene-2-carboxamide |
| SMILES | CCNC(=O)c1sc(N2CCC(C)C2)c(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C13H21N3O3S2/c1-4-15-12(17)10-9(14)11(21(3,18)19)13(20-10)16-6-5-8(2)7-16/h8H,4-7,14H2,1-3H3,(H,15,17) |
| InChIKey | YZKRQYJMEZGYGV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |