C14H24N4OS2 — CID 103418732
3-amino-N-ethyl-5-(4-ethylpiperazin-1-yl)-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103418732) has the molecular formula C14H24N4OS2 and a molecular weight of 328.51 g/mol. Its IUPAC name is 3-amino-N-ethyl-5-(4-ethylpiperazin-1-yl)-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-N-ethyl-5-(4-ethylpiperazin-1-yl)-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103418732 |
| Molecular Formula | C14H24N4OS2 |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-amino-N-ethyl-5-(4-ethylpiperazin-1-yl)-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CCNC(=O)c1sc(N2CCN(CC)CC2)c(SC)c1N |
| InChI | InChI=1S/C14H24N4OS2/c1-4-16-13(19)11-10(15)12(20-3)14(21-11)18-8-6-17(5-2)7-9-18/h4-9,15H2,1-3H3,(H,16,19) |
| InChIKey | TWDFXGKXJYNMSD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |