About 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide
3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide (PubChem CID 103506771) has the molecular formula C15H25N3OS2
and a molecular weight of 327.52 g/mol. Its IUPAC name is 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide |
| PubChem CID | 103506771 |
| Molecular Formula | C15H25N3OS2 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide |
| SMILES | CCCNC(=O)c1sc(N2CC(C)C(C)C2)c(SC)c1N |
| InChI | InChI=1S/C15H25N3OS2/c1-5-6-17-14(19)12-11(16)13(20-4)15(21-12)18-7-9(2)10(3)8-18/h9-10H,5-8,16H2,1-4H3,(H,17,19) |
| InChIKey | LGKQKWMBZUVQEC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide?
The IUPAC name of 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide (CID 103506771) is 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide.
What is the SMILES notation for 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide?
The canonical SMILES for 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide is CCCNC(=O)c1sc(N2CC(C)C(C)C2)c(SC)c1N.
What is the InChIKey of 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide?
The InChIKey is LGKQKWMBZUVQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3OS2/c1-5-6-17-14(19)12-11(16)13(20-4)15(21-12)18-7-9(2)10(3)8-18/h9-10H,5-8,16H2,1-4H3,(H,17,19).
What are the key properties of 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide?
3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide has a molecular weight of 327.52 g/mol, XLogP of 3.28, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(3,4-dimethylpyrrolidin-1-yl)-4-methylsulfanyl-N-propylthiophene-2-carboxamide is sourced from PubChem (CID 103506771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).