C15H27N3OS2 — CID 103420142
3-amino-5-(hexylamino)-4-methylsulfanyl-N-propylthiophene-2-carboxamide (PubChem CID 103420142) has the molecular formula C15H27N3OS2 and a molecular weight of 329.54 g/mol. Its IUPAC name is 3-amino-5-(hexylamino)-4-methylsulfanyl-N-propylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(hexylamino)-4-methylsulfanyl-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103420142 |
| Molecular Formula | C15H27N3OS2 |
| Molecular Weight | 329.54 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 3-amino-5-(hexylamino)-4-methylsulfanyl-N-propylthiophene-2-carboxamide |
| SMILES | CCCCCCNc1sc(C(=O)NCCC)c(N)c1SC |
| InChI | InChI=1S/C15H27N3OS2/c1-4-6-7-8-10-18-15-13(20-3)11(16)12(21-15)14(19)17-9-5-2/h18H,4-10,16H2,1-3H3,(H,17,19) |
| InChIKey | MDNRJZPEIICVRU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|