C13H22N2O2S2 — CID 103427005
1-[3-amino-5-(3-methoxypropylamino)-4-methylsulfanylthiophen-2-yl]-2-methylpropan-1-one (PubChem CID 103427005) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is 1-[3-amino-5-(3-methoxypropylamino)-4-methylsulfanylthiophen-2-yl]-2-methylpropan-1-one.
| Compound Name | 1-[3-amino-5-(3-methoxypropylamino)-4-methylsulfanylthiophen-2-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 103427005 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-[3-amino-5-(3-methoxypropylamino)-4-methylsulfanylthiophen-2-yl]-2-methylpropan-1-one |
| SMILES | COCCCNc1sc(C(=O)C(C)C)c(N)c1SC |
| InChI | InChI=1S/C13H22N2O2S2/c1-8(2)10(16)11-9(14)12(18-4)13(19-11)15-6-5-7-17-3/h8,15H,5-7,14H2,1-4H3 |
| InChIKey | ANFUAELMBGKWNG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|