C14H24N2OS2 — CID 103425378
1-[3-amino-4-methylsulfanyl-5-(pentylamino)thiophen-2-yl]-2-methylpropan-1-one (PubChem CID 103425378) has the molecular formula C14H24N2OS2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 1-[3-amino-4-methylsulfanyl-5-(pentylamino)thiophen-2-yl]-2-methylpropan-1-one.
| Compound Name | 1-[3-amino-4-methylsulfanyl-5-(pentylamino)thiophen-2-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 103425378 |
| Molecular Formula | C14H24N2OS2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-[3-amino-4-methylsulfanyl-5-(pentylamino)thiophen-2-yl]-2-methylpropan-1-one |
| SMILES | CCCCCNc1sc(C(=O)C(C)C)c(N)c1SC |
| InChI | InChI=1S/C14H24N2OS2/c1-5-6-7-8-16-14-13(18-4)10(15)12(19-14)11(17)9(2)3/h9,16H,5-8,15H2,1-4H3 |
| InChIKey | YCTSFUBINKTECE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|