C13H20N2OS2 — CID 103525936
1-[3-amino-5-(cyclobutylamino)-4-methylsulfanylthiophen-2-yl]-2-methylpropan-1-one (PubChem CID 103525936) has the molecular formula C13H20N2OS2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 1-[3-amino-5-(cyclobutylamino)-4-methylsulfanylthiophen-2-yl]-2-methylpropan-1-one.
| Compound Name | 1-[3-amino-5-(cyclobutylamino)-4-methylsulfanylthiophen-2-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 103525936 |
| Molecular Formula | C13H20N2OS2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-[3-amino-5-(cyclobutylamino)-4-methylsulfanylthiophen-2-yl]-2-methylpropan-1-one |
| SMILES | CSc1c(NC2CCC2)sc(C(=O)C(C)C)c1N |
| InChI | InChI=1S/C13H20N2OS2/c1-7(2)10(16)11-9(14)12(17-3)13(18-11)15-8-5-4-6-8/h7-8,15H,4-6,14H2,1-3H3 |
| InChIKey | UVDWVODDAXMZIX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |