C15H24N2OS2 — CID 103508345
1-[3-amino-5-[(4-ethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]ethanone (PubChem CID 103508345) has the molecular formula C15H24N2OS2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 1-[3-amino-5-[(4-ethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]ethanone.
| Compound Name | 1-[3-amino-5-[(4-ethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 103508345 |
| Molecular Formula | C15H24N2OS2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[3-amino-5-[(4-ethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]ethanone |
| SMILES | CCC1CCC(Nc2sc(C(C)=O)c(N)c2SC)CC1 |
| InChI | InChI=1S/C15H24N2OS2/c1-4-10-5-7-11(8-6-10)17-15-14(19-3)12(16)13(20-15)9(2)18/h10-11,17H,4-8,16H2,1-3H3 |
| InChIKey | JYMWXTRREARDAK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |