About 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one
1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one (PubChem CID 103508116) has the molecular formula C16H26N2OS2
and a molecular weight of 326.53 g/mol. Its IUPAC name is 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one |
| PubChem CID | 103508116 |
| Molecular Formula | C16H26N2OS2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one |
| SMILES | CCC(=O)c1sc(NC2CCC(C)(C)CC2)c(SC)c1N |
| InChI | InChI=1S/C16H26N2OS2/c1-5-11(19)13-12(17)14(20-4)15(21-13)18-10-6-8-16(2,3)9-7-10/h10,18H,5-9,17H2,1-4H3 |
| InChIKey | ASSXVNYAMUOSIV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one?
The IUPAC name of 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one (CID 103508116) is 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one.
What is the SMILES notation for 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one?
The canonical SMILES for 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one is CCC(=O)c1sc(NC2CCC(C)(C)CC2)c(SC)c1N.
What is the InChIKey of 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one?
The InChIKey is ASSXVNYAMUOSIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2OS2/c1-5-11(19)13-12(17)14(20-4)15(21-13)18-10-6-8-16(2,3)9-7-10/h10,18H,5-9,17H2,1-4H3.
What are the key properties of 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one?
1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one has a molecular weight of 326.53 g/mol, XLogP of 5.03, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-amino-5-[(4,4-dimethylcyclohexyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one is sourced from PubChem (CID 103508116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).