About 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one
1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one (PubChem CID 103526629) has the molecular formula C9H13NOS3
and a molecular weight of 247.41 g/mol. Its IUPAC name is 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one |
| PubChem CID | 103526629 |
| Molecular Formula | C9H13NOS3 |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one |
| SMILES | CCC(=O)c1sc(SC)c(SC)c1N |
| InChI | InChI=1S/C9H13NOS3/c1-4-5(11)7-6(10)8(12-2)9(13-3)14-7/h4,10H2,1-3H3 |
| InChIKey | JQOPHCCANANIJW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one?
The IUPAC name of 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one (CID 103526629) is 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one.
What is the SMILES notation for 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one?
The canonical SMILES for 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one is CCC(=O)c1sc(SC)c(SC)c1N.
What is the InChIKey of 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one?
The InChIKey is JQOPHCCANANIJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NOS3/c1-4-5(11)7-6(10)8(12-2)9(13-3)14-7/h4,10H2,1-3H3.
What are the key properties of 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one?
1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one has a molecular weight of 247.41 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-amino-4,5-bis(methylsulfanyl)thiophen-2-yl]propan-1-one is sourced from PubChem (CID 103526629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).