C16H20N2OS2 — CID 103431839
1-[3-amino-5-[(2-methylphenyl)methylamino]-4-methylsulfanylthiophen-2-yl]propan-1-one (PubChem CID 103431839) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-[3-amino-5-[(2-methylphenyl)methylamino]-4-methylsulfanylthiophen-2-yl]propan-1-one.
| Compound Name | 1-[3-amino-5-[(2-methylphenyl)methylamino]-4-methylsulfanylthiophen-2-yl]propan-1-one |
|---|---|
| PubChem CID | 103431839 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-[3-amino-5-[(2-methylphenyl)methylamino]-4-methylsulfanylthiophen-2-yl]propan-1-one |
| SMILES | CCC(=O)c1sc(NCc2ccccc2C)c(SC)c1N |
| InChI | InChI=1S/C16H20N2OS2/c1-4-12(19)14-13(17)15(20-3)16(21-14)18-9-11-8-6-5-7-10(11)2/h5-8,18H,4,9,17H2,1-3H3 |
| InChIKey | ACDQUWQIUBNXMG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |