C10H17N3OS2 — CID 103423765
3-amino-5-(2-methylpropylamino)-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103423765) has the molecular formula C10H17N3OS2 and a molecular weight of 259.40 g/mol. Its IUPAC name is 3-amino-5-(2-methylpropylamino)-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(2-methylpropylamino)-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103423765 |
| Molecular Formula | C10H17N3OS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-amino-5-(2-methylpropylamino)-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CSc1c(NCC(C)C)sc(C(N)=O)c1N |
| InChI | InChI=1S/C10H17N3OS2/c1-5(2)4-13-10-8(15-3)6(11)7(16-10)9(12)14/h5,13H,4,11H2,1-3H3,(H2,12,14) |
| InChIKey | NJHOOSPKLMUVSB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |