C10H18N4OS2 — CID 103424297
3-amino-5-[2-(dimethylamino)ethylamino]-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103424297) has the molecular formula C10H18N4OS2 and a molecular weight of 274.41 g/mol. Its IUPAC name is 3-amino-5-[2-(dimethylamino)ethylamino]-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[2-(dimethylamino)ethylamino]-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103424297 |
| Molecular Formula | C10H18N4OS2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 3-amino-5-[2-(dimethylamino)ethylamino]-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CSc1c(NCCN(C)C)sc(C(N)=O)c1N |
| InChI | InChI=1S/C10H18N4OS2/c1-14(2)5-4-13-10-8(16-3)6(11)7(17-10)9(12)15/h13H,4-5,11H2,1-3H3,(H2,12,15) |
| InChIKey | XDGSQPPOGSWAFY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |