C13H13BrFN3OS2 — CID 103507750
3-amino-5-[(5-bromo-2-fluorophenyl)methylamino]-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103507750) has the molecular formula C13H13BrFN3OS2 and a molecular weight of 390.30 g/mol. Its IUPAC name is 3-amino-5-[(5-bromo-2-fluorophenyl)methylamino]-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[(5-bromo-2-fluorophenyl)methylamino]-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103507750 |
| Molecular Formula | C13H13BrFN3OS2 |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 3-amino-5-[(5-bromo-2-fluorophenyl)methylamino]-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CSc1c(NCc2cc(Br)ccc2F)sc(C(N)=O)c1N |
| InChI | InChI=1S/C13H13BrFN3OS2/c1-20-11-9(16)10(12(17)19)21-13(11)18-5-6-4-7(14)2-3-8(6)15/h2-4,18H,5,16H2,1H3,(H2,17,19) |
| InChIKey | HHZCMLFXUOVNQG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |