C15H17BrN2OS2 — CID 103507864
1-[3-amino-5-[(3-bromophenyl)methylamino]-4-methylsulfanylthiophen-2-yl]propan-1-one (PubChem CID 103507864) has the molecular formula C15H17BrN2OS2 and a molecular weight of 385.35 g/mol. Its IUPAC name is 1-[3-amino-5-[(3-bromophenyl)methylamino]-4-methylsulfanylthiophen-2-yl]propan-1-one.
| Compound Name | 1-[3-amino-5-[(3-bromophenyl)methylamino]-4-methylsulfanylthiophen-2-yl]propan-1-one |
|---|---|
| PubChem CID | 103507864 |
| Molecular Formula | C15H17BrN2OS2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 1-[3-amino-5-[(3-bromophenyl)methylamino]-4-methylsulfanylthiophen-2-yl]propan-1-one |
| SMILES | CCC(=O)c1sc(NCc2cccc(Br)c2)c(SC)c1N |
| InChI | InChI=1S/C15H17BrN2OS2/c1-3-11(19)13-12(17)14(20-2)15(21-13)18-8-9-5-4-6-10(16)7-9/h4-7,18H,3,8,17H2,1-2H3 |
| InChIKey | AHYVBYMWAYGQCV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |