C16H20N2OS2 — CID 103420298
1-[3-amino-5-[benzyl(methyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one (PubChem CID 103420298) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-[3-amino-5-[benzyl(methyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one.
| Compound Name | 1-[3-amino-5-[benzyl(methyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one |
|---|---|
| PubChem CID | 103420298 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-[3-amino-5-[benzyl(methyl)amino]-4-methylsulfanylthiophen-2-yl]propan-1-one |
| SMILES | CCC(=O)c1sc(N(C)Cc2ccccc2)c(SC)c1N |
| InChI | InChI=1S/C16H20N2OS2/c1-4-12(19)14-13(17)15(20-3)16(21-14)18(2)10-11-8-6-5-7-9-11/h5-9H,4,10,17H2,1-3H3 |
| InChIKey | UMYAHKNNAOCFFL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |