C11H20N4OS2 — CID 103422189
3-amino-5-[2-(dimethylamino)ethyl-methylamino]-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103422189) has the molecular formula C11H20N4OS2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 3-amino-5-[2-(dimethylamino)ethyl-methylamino]-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[2-(dimethylamino)ethyl-methylamino]-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103422189 |
| Molecular Formula | C11H20N4OS2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-amino-5-[2-(dimethylamino)ethyl-methylamino]-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CSc1c(N(C)CCN(C)C)sc(C(N)=O)c1N |
| InChI | InChI=1S/C11H20N4OS2/c1-14(2)5-6-15(3)11-9(17-4)7(12)8(18-11)10(13)16/h5-6,12H2,1-4H3,(H2,13,16) |
| InChIKey | BHPHWWXOGYTBNN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |