C13H21N3OS2 — CID 107403343
3-amino-5-[cyclobutylmethyl(ethyl)amino]-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 107403343) has the molecular formula C13H21N3OS2 and a molecular weight of 299.47 g/mol. Its IUPAC name is 3-amino-5-[cyclobutylmethyl(ethyl)amino]-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[cyclobutylmethyl(ethyl)amino]-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107403343 |
| Molecular Formula | C13H21N3OS2 |
| Molecular Weight | 299.47 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-amino-5-[cyclobutylmethyl(ethyl)amino]-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CCN(CC1CCC1)c1sc(C(N)=O)c(N)c1SC |
| InChI | InChI=1S/C13H21N3OS2/c1-3-16(7-8-5-4-6-8)13-11(18-2)9(14)10(19-13)12(15)17/h8H,3-7,14H2,1-2H3,(H2,15,17) |
| InChIKey | NKLVFBXDHARHQZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |