C12H21N3OS2 — CID 103420758
3-amino-5-[ethyl(2-methylpropyl)amino]-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103420758) has the molecular formula C12H21N3OS2 and a molecular weight of 287.45 g/mol. Its IUPAC name is 3-amino-5-[ethyl(2-methylpropyl)amino]-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[ethyl(2-methylpropyl)amino]-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103420758 |
| Molecular Formula | C12H21N3OS2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-amino-5-[ethyl(2-methylpropyl)amino]-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CCN(CC(C)C)c1sc(C(N)=O)c(N)c1SC |
| InChI | InChI=1S/C12H21N3OS2/c1-5-15(6-7(2)3)12-10(17-4)8(13)9(18-12)11(14)16/h7H,5-6,13H2,1-4H3,(H2,14,16) |
| InChIKey | VCSGECYCXQBTJL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |