C15H24N2O2S2 — CID 107403366
ethyl 3-amino-5-[cyclobutylmethyl(ethyl)amino]-4-methylsulfanylthiophene-2-carboxylate (PubChem CID 107403366) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is ethyl 3-amino-5-[cyclobutylmethyl(ethyl)amino]-4-methylsulfanylthiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-5-[cyclobutylmethyl(ethyl)amino]-4-methylsulfanylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 107403366 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | ethyl 3-amino-5-[cyclobutylmethyl(ethyl)amino]-4-methylsulfanylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(N(CC)CC2CCC2)c(SC)c1N |
| InChI | InChI=1S/C15H24N2O2S2/c1-4-17(9-10-7-6-8-10)14-12(20-3)11(16)13(21-14)15(18)19-5-2/h10H,4-9,16H2,1-3H3 |
| InChIKey | OWUBPUMKYFUTSC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |