C13H21N3O3S — CID 103421055
ethyl 3-amino-4-carbamoyl-5-[ethyl(propyl)amino]thiophene-2-carboxylate (PubChem CID 103421055) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is ethyl 3-amino-4-carbamoyl-5-[ethyl(propyl)amino]thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-4-carbamoyl-5-[ethyl(propyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103421055 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | ethyl 3-amino-4-carbamoyl-5-[ethyl(propyl)amino]thiophene-2-carboxylate |
| SMILES | CCCN(CC)c1sc(C(=O)OCC)c(N)c1C(N)=O |
| InChI | InChI=1S/C13H21N3O3S/c1-4-7-16(5-2)12-8(11(15)17)9(14)10(20-12)13(18)19-6-3/h4-7,14H2,1-3H3,(H2,15,17) |
| InChIKey | ZKFGUWPRNQZNPT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |