About 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide
3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide (PubChem CID 103420533) has the molecular formula C14H24N4O2S
and a molecular weight of 312.44 g/mol. Its IUPAC name is 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide.
Molecular Properties
| Compound Name | 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide |
| PubChem CID | 103420533 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide |
| SMILES | CCCCN(CC)c1sc(C(=O)N(C)C)c(N)c1C(N)=O |
| InChI | InChI=1S/C14H24N4O2S/c1-5-7-8-18(6-2)14-9(12(16)19)10(15)11(21-14)13(20)17(3)4/h5-8,15H2,1-4H3,(H2,16,19) |
| InChIKey | BSEHYUQJGWCMAO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide?
The IUPAC name of 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide (CID 103420533) is 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide.
What is the SMILES notation for 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide?
The canonical SMILES for 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide is CCCCN(CC)c1sc(C(=O)N(C)C)c(N)c1C(N)=O.
What is the InChIKey of 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide?
The InChIKey is BSEHYUQJGWCMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O2S/c1-5-7-8-18(6-2)14-9(12(16)19)10(15)11(21-14)13(20)17(3)4/h5-8,15H2,1-4H3,(H2,16,19).
What are the key properties of 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide?
3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide has a molecular weight of 312.44 g/mol, XLogP of 1.76, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-[butyl(ethyl)amino]-2-N,2-N-dimethylthiophene-2,4-dicarboxamide is sourced from PubChem (CID 103420533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).