C14H22N2O3S — CID 103421006
ethyl 5-acetyl-4-amino-2-[ethyl(propyl)amino]thiophene-3-carboxylate (PubChem CID 103421006) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is ethyl 5-acetyl-4-amino-2-[ethyl(propyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-4-amino-2-[ethyl(propyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103421006 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | ethyl 5-acetyl-4-amino-2-[ethyl(propyl)amino]thiophene-3-carboxylate |
| SMILES | CCCN(CC)c1sc(C(C)=O)c(N)c1C(=O)OCC |
| InChI | InChI=1S/C14H22N2O3S/c1-5-8-16(6-2)13-10(14(18)19-7-3)11(15)12(20-13)9(4)17/h5-8,15H2,1-4H3 |
| InChIKey | MPUPRILWRYHUGO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |