C12H20N2O2S — CID 103421072
1-[3-amino-5-[ethyl(propyl)amino]-4-methoxythiophen-2-yl]ethanone (PubChem CID 103421072) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-[3-amino-5-[ethyl(propyl)amino]-4-methoxythiophen-2-yl]ethanone.
| Compound Name | 1-[3-amino-5-[ethyl(propyl)amino]-4-methoxythiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 103421072 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-[3-amino-5-[ethyl(propyl)amino]-4-methoxythiophen-2-yl]ethanone |
| SMILES | CCCN(CC)c1sc(C(C)=O)c(N)c1OC |
| InChI | InChI=1S/C12H20N2O2S/c1-5-7-14(6-2)12-10(16-4)9(13)11(17-12)8(3)15/h5-7,13H2,1-4H3 |
| InChIKey | VXXXKHAFZPCEPS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |